C11H13FN4O3S — CID 106413720
2-amino-3-fluoro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide (PubChem CID 106413720) has the molecular formula C11H13FN4O3S and a molecular weight of 300.31 g/mol. Its IUPAC name is 2-amino-3-fluoro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-3-fluoro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106413720 |
| Molecular Formula | C11H13FN4O3S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-amino-3-fluoro-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1noc(CCNS(=O)(=O)c2cccc(F)c2N)n1 |
| InChI | InChI=1S/C11H13FN4O3S/c1-7-15-10(19-16-7)5-6-14-20(17,18)9-4-2-3-8(12)11(9)13/h2-4,14H,5-6,13H2,1H3 |
| InChIKey | JDDALEUPVRNZBZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|