C10H14N6O3S — CID 106419522
2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 106419522) has the molecular formula C10H14N6O3S and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106419522 |
| Molecular Formula | C10H14N6O3S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-hydrazinyl-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2cccnc2NN)no1 |
| InChI | InChI=1S/C10H14N6O3S/c1-7-14-9(16-19-7)4-6-13-20(17,18)8-3-2-5-12-10(8)15-11/h2-3,5,13H,4,6,11H2,1H3,(H,12,15) |
| InChIKey | DHYFODYEXHHMJX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|