C10H11ClN4O3S — CID 113239631
2-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 113239631) has the molecular formula C10H11ClN4O3S and a molecular weight of 302.74 g/mol. Its IUPAC name is 2-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113239631 |
| Molecular Formula | C10H11ClN4O3S |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-chloro-N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2cccnc2Cl)no1 |
| InChI | InChI=1S/C10H11ClN4O3S/c1-7-14-9(15-18-7)4-6-13-19(16,17)8-3-2-5-12-10(8)11/h2-3,5,13H,4,6H2,1H3 |
| InChIKey | IIGBJTFIQOMABD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|