C13H17ClN4O2S — CID 61217770
2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-sulfonamide (PubChem CID 61217770) has the molecular formula C13H17ClN4O2S and a molecular weight of 328.83 g/mol. Its IUPAC name is 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61217770 |
| Molecular Formula | C13H17ClN4O2S |
| Molecular Weight | 328.83 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]pyridine-3-sulfonamide |
| SMILES | Cc1cc(C)n(CCCNS(=O)(=O)c2cccnc2Cl)n1 |
| InChI | InChI=1S/C13H17ClN4O2S/c1-10-9-11(2)18(17-10)8-4-7-16-21(19,20)12-5-3-6-15-13(12)14/h3,5-6,9,16H,4,7-8H2,1-2H3 |
| InChIKey | QOBFVIFCLPHZFU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|