C12H16ClN3O2S2 — CID 22207528
5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiophene-2-sulfonamide (PubChem CID 22207528) has the molecular formula C12H16ClN3O2S2 and a molecular weight of 333.87 g/mol. Its IUPAC name is 5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 22207528 |
| Molecular Formula | C12H16ClN3O2S2 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 5-chloro-N-[3-(3,5-dimethylpyrazol-1-yl)propyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(C)n(CCCNS(=O)(=O)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C12H16ClN3O2S2/c1-9-8-10(2)16(15-9)7-3-6-14-20(17,18)12-5-4-11(13)19-12/h4-5,8,14H,3,6-7H2,1-2H3 |
| InChIKey | CAFQRQZIASHWBT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|