C13H15Cl2N3O2S — CID 110716709
3,4-dichloro-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 110716709) has the molecular formula C13H15Cl2N3O2S and a molecular weight of 348.26 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110716709 |
| Molecular Formula | C13H15Cl2N3O2S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3,4-dichloro-N-[2-(3,5-dimethylpyrazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)n(CCNS(=O)(=O)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H15Cl2N3O2S/c1-9-7-10(2)18(17-9)6-5-16-21(19,20)11-3-4-12(14)13(15)8-11/h3-4,7-8,16H,5-6H2,1-2H3 |
| InChIKey | QWNFWIBXWPHTDR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |