C9H11Cl2NO4S2 — CID 110359442
3,4-dichloro-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 110359442) has the molecular formula C9H11Cl2NO4S2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110359442 |
| Molecular Formula | C9H11Cl2NO4S2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 3,4-dichloro-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H11Cl2NO4S2/c1-17(13,14)5-4-12-18(15,16)7-2-3-8(10)9(11)6-7/h2-3,6,12H,4-5H2,1H3 |
| InChIKey | BOLWLNVCVGNFMS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |