C11H13ClN2O4S2 — CID 115591016
3-chloro-4-cyano-N-(3-methylsulfonylpropyl)benzenesulfonamide (PubChem CID 115591016) has the molecular formula C11H13ClN2O4S2 and a molecular weight of 336.82 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(3-methylsulfonylpropyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(3-methylsulfonylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115591016 |
| Molecular Formula | C11H13ClN2O4S2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 3-chloro-4-cyano-N-(3-methylsulfonylpropyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClN2O4S2/c1-19(15,16)6-2-5-14-20(17,18)10-4-3-9(8-13)11(12)7-10/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | IRPMHFLQPILDJI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|