C13H15ClN2O2S — CID 115690473
3-chloro-4-cyano-N-(2-cyclobutylethyl)benzenesulfonamide (PubChem CID 115690473) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(2-cyclobutylethyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(2-cyclobutylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115690473 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-chloro-4-cyano-N-(2-cyclobutylethyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCC2CCC2)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O2S/c14-13-8-12(5-4-11(13)9-15)19(17,18)16-7-6-10-2-1-3-10/h4-5,8,10,16H,1-3,6-7H2 |
| InChIKey | BVEABGQBKQJVRR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |