C14H19ClN4O2S — CID 51115598
3-chloro-4-cyano-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 51115598) has the molecular formula C14H19ClN4O2S and a molecular weight of 342.85 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51115598 |
| Molecular Formula | C14H19ClN4O2S |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-chloro-4-cyano-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | CN1CCN(CCNS(=O)(=O)c2ccc(C#N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H19ClN4O2S/c1-18-6-8-19(9-7-18)5-4-17-22(20,21)13-3-2-12(11-16)14(15)10-13/h2-3,10,17H,4-9H2,1H3 |
| InChIKey | BRUOMBRWHVQWNG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |