C13H13ClN4O2S — CID 104693945
3-chloro-4-cyano-N-[2-(2-methylpyrazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 104693945) has the molecular formula C13H13ClN4O2S and a molecular weight of 324.79 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[2-(2-methylpyrazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[2-(2-methylpyrazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104693945 |
| Molecular Formula | C13H13ClN4O2S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-chloro-4-cyano-N-[2-(2-methylpyrazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1nccc1CCNS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClN4O2S/c1-18-11(4-6-16-18)5-7-17-21(19,20)12-3-2-10(9-15)13(14)8-12/h2-4,6,8,17H,5,7H2,1H3 |
| InChIKey | DHXCFELETCWFLQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |