C10H11ClN4O3S — CID 112691993
2-[(3-chloro-4-cyanophenyl)sulfonylamino]ethylurea (PubChem CID 112691993) has the molecular formula C10H11ClN4O3S and a molecular weight of 302.74 g/mol. Its IUPAC name is 2-[(3-chloro-4-cyanophenyl)sulfonylamino]ethylurea.
| Compound Name | 2-[(3-chloro-4-cyanophenyl)sulfonylamino]ethylurea |
|---|---|
| PubChem CID | 112691993 |
| Molecular Formula | C10H11ClN4O3S |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-[(3-chloro-4-cyanophenyl)sulfonylamino]ethylurea |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCNC(N)=O)cc1Cl |
| InChI | InChI=1S/C10H11ClN4O3S/c11-9-5-8(2-1-7(9)6-12)19(17,18)15-4-3-14-10(13)16/h1-2,5,15H,3-4H2,(H3,13,14,16) |
| InChIKey | WOEDYYIWVFIZHB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|