C12H13ClN2O2S — CID 115628680
3-chloro-4-cyano-N-[(E)-pent-3-enyl]benzenesulfonamide (PubChem CID 115628680) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[(E)-pent-3-enyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[(E)-pent-3-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115628680 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-chloro-4-cyano-N-[(E)-pent-3-enyl]benzenesulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O2S/c1-2-3-4-7-15-18(16,17)11-6-5-10(9-14)12(13)8-11/h2-3,5-6,8,15H,4,7H2,1H3/b3-2+ |
| InChIKey | XPANITNHSASQCL-NSCUHMNNSA-N |
| XLogP | 2.46 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|