C12H13ClF3NO2S — CID 115628739
4-chloro-N-[(E)-pent-3-enyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 115628739) has the molecular formula C12H13ClF3NO2S and a molecular weight of 327.76 g/mol. Its IUPAC name is 4-chloro-N-[(E)-pent-3-enyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[(E)-pent-3-enyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115628739 |
| Molecular Formula | C12H13ClF3NO2S |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 4-chloro-N-[(E)-pent-3-enyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NO2S/c1-2-3-4-7-17-20(18,19)9-5-6-11(13)10(8-9)12(14,15)16/h2-3,5-6,8,17H,4,7H2,1H3/b3-2+ |
| InChIKey | ZXMCVBQJCQSAAL-NSCUHMNNSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|