C10H11ClF3NO2S — CID 2443168
4-chloro-N-propyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 2443168) has the molecular formula C10H11ClF3NO2S and a molecular weight of 301.72 g/mol. Its IUPAC name is 4-chloro-N-propyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-propyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2443168 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-chloro-N-propyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11ClF3NO2S/c1-2-5-15-18(16,17)7-3-4-9(11)8(6-7)10(12,13)14/h3-4,6,15H,2,5H2,1H3 |
| InChIKey | ZNAGVSROQXLOQF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |