C15H21ClF3N2O2S+ — CID 8823983
4-chloro-N-(3-piperidin-1-ium-1-ylpropyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 8823983) has the molecular formula C15H21ClF3N2O2S+ and a molecular weight of 385.86 g/mol. Its IUPAC name is 4-chloro-N-(3-piperidin-1-ium-1-ylpropyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(3-piperidin-1-ium-1-ylpropyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8823983 |
| Molecular Formula | C15H21ClF3N2O2S+ |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-chloro-N-(3-piperidin-1-ium-1-ylpropyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCC[NH+]1CCCCC1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20ClF3N2O2S/c16-14-6-5-12(11-13(14)15(17,18)19)24(22,23)20-7-4-10-21-8-2-1-3-9-21/h5-6,11,20H,1-4,7-10H2/p+1 |
| InChIKey | FENTWHJIXCWPHS-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|