C12H16ClF3N2O2S — CID 43606545
4-chloro-N-[3-(ethylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 43606545) has the molecular formula C12H16ClF3N2O2S and a molecular weight of 344.79 g/mol. Its IUPAC name is 4-chloro-N-[3-(ethylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(ethylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43606545 |
| Molecular Formula | C12H16ClF3N2O2S |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 4-chloro-N-[3-(ethylamino)propyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCNCCCNS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16ClF3N2O2S/c1-2-17-6-3-7-18-21(19,20)9-4-5-11(13)10(8-9)12(14,15)16/h4-5,8,17-18H,2-3,6-7H2,1H3 |
| InChIKey | WWYQTYVTASZXDD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|