C10H15BrCl2N2O2S — CID 120708859
3-bromo-4-chloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120708859) has the molecular formula C10H15BrCl2N2O2S and a molecular weight of 378.12 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 3-bromo-4-chloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120708859 |
| Molecular Formula | C10H15BrCl2N2O2S |
| Molecular Weight | 378.12 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | 3-bromo-4-chloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1ccc(Cl)c(Br)c1.Cl |
| InChI | InChI=1S/C10H14BrClN2O2S.ClH/c1-2-13-5-6-14-17(15,16)8-3-4-10(12)9(11)7-8;/h3-4,7,13-14H,2,5-6H2,1H3;1H |
| InChIKey | WCJVMJHXBGHCHX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.12 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|