C10H14BrCl3N2O2S — CID 120708903
4-bromo-2,3-dichloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120708903) has the molecular formula C10H14BrCl3N2O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-bromo-2,3-dichloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120708903 |
| Molecular Formula | C10H14BrCl3N2O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[2-(ethylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCNCCNS(=O)(=O)c1ccc(Br)c(Cl)c1Cl.Cl |
| InChI | InChI=1S/C10H13BrCl2N2O2S.ClH/c1-2-14-5-6-15-18(16,17)8-4-3-7(11)9(12)10(8)13;/h3-4,14-15H,2,5-6H2,1H3;1H |
| InChIKey | SQRRQJVHKSGCBX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|