C9H11BrCl2N2O2S — CID 120708767
4-bromo-2,3-dichloro-N-[2-(methylamino)ethyl]benzenesulfonamide (PubChem CID 120708767) has the molecular formula C9H11BrCl2N2O2S and a molecular weight of 362.08 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[2-(methylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-2,3-dichloro-N-[2-(methylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 120708767 |
| Molecular Formula | C9H11BrCl2N2O2S |
| Molecular Weight | 362.08 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[2-(methylamino)ethyl]benzenesulfonamide |
| SMILES | CNCCNS(=O)(=O)c1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C9H11BrCl2N2O2S/c1-13-4-5-14-17(15,16)7-3-2-6(10)8(11)9(7)12/h2-3,13-14H,4-5H2,1H3 |
| InChIKey | BWPMYIHGRLNPDG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.08 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|