C9H13BrClFN2O2S — CID 119973263
4-bromo-3-fluoro-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 119973263) has the molecular formula C9H13BrClFN2O2S and a molecular weight of 347.64 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-bromo-3-fluoro-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973263 |
| Molecular Formula | C9H13BrClFN2O2S |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 4-bromo-3-fluoro-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1ccc(Br)c(F)c1.Cl |
| InChI | InChI=1S/C9H12BrFN2O2S.ClH/c1-12-4-5-13-16(14,15)7-2-3-8(10)9(11)6-7;/h2-3,6,12-13H,4-5H2,1H3;1H |
| InChIKey | YMGWQPPGEKAOGG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|