C11H15BrFNO3S — CID 113431383
4-bromo-3-fluoro-N-(2-propan-2-yloxyethyl)benzenesulfonamide (PubChem CID 113431383) has the molecular formula C11H15BrFNO3S and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-(2-propan-2-yloxyethyl)benzenesulfonamide.
| Compound Name | 4-bromo-3-fluoro-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113431383 |
| Molecular Formula | C11H15BrFNO3S |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 4-bromo-3-fluoro-N-(2-propan-2-yloxyethyl)benzenesulfonamide |
| SMILES | CC(C)OCCNS(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C11H15BrFNO3S/c1-8(2)17-6-5-14-18(15,16)9-3-4-10(12)11(13)7-9/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | YOBAWOWYARQMFG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|