C11H16ClNO5S2 — CID 104761565
3-(2-propan-2-yloxyethylsulfamoyl)benzenesulfonyl chloride (PubChem CID 104761565) has the molecular formula C11H16ClNO5S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-(2-propan-2-yloxyethylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 3-(2-propan-2-yloxyethylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 104761565 |
| Molecular Formula | C11H16ClNO5S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-(2-propan-2-yloxyethylsulfamoyl)benzenesulfonyl chloride |
| SMILES | CC(C)OCCNS(=O)(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C11H16ClNO5S2/c1-9(2)18-7-6-13-20(16,17)11-5-3-4-10(8-11)19(12,14)15/h3-5,8-9,13H,6-7H2,1-2H3 |
| InChIKey | IUUQPTMUTKHHGD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|