C12H20N2O5S2 — CID 115588283
3-N-[2-(2-methylpropoxy)ethyl]benzene-1,3-disulfonamide (PubChem CID 115588283) has the molecular formula C12H20N2O5S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-N-[2-(2-methylpropoxy)ethyl]benzene-1,3-disulfonamide.
| Compound Name | 3-N-[2-(2-methylpropoxy)ethyl]benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 115588283 |
| Molecular Formula | C12H20N2O5S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-N-[2-(2-methylpropoxy)ethyl]benzene-1,3-disulfonamide |
| SMILES | CC(C)COCCNS(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H20N2O5S2/c1-10(2)9-19-7-6-14-21(17,18)12-5-3-4-11(8-12)20(13,15)16/h3-5,8,10,14H,6-7,9H2,1-2H3,(H2,13,15,16) |
| InChIKey | RKQPMJQXLHHSHZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|