C15H19NO5S — CID 87024847
N-[2-(2-methylpropoxy)ethyl]-2-oxochromene-6-sulfonamide (PubChem CID 87024847) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[2-(2-methylpropoxy)ethyl]-2-oxochromene-6-sulfonamide.
| Compound Name | N-[2-(2-methylpropoxy)ethyl]-2-oxochromene-6-sulfonamide |
|---|---|
| PubChem CID | 87024847 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[2-(2-methylpropoxy)ethyl]-2-oxochromene-6-sulfonamide |
| SMILES | CC(C)COCCNS(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C15H19NO5S/c1-11(2)10-20-8-7-16-22(18,19)13-4-5-14-12(9-13)3-6-15(17)21-14/h3-6,9,11,16H,7-8,10H2,1-2H3 |
| InChIKey | WPOFTHWOYWXMNK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|