C17H21NO6S — CID 32955601
2-oxo-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]chromene-6-sulfonamide (PubChem CID 32955601) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-oxo-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]chromene-6-sulfonamide.
| Compound Name | 2-oxo-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]chromene-6-sulfonamide |
|---|---|
| PubChem CID | 32955601 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-oxo-N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]chromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)NCCCOC[C@H]3CCCO3)ccc2o1 |
| InChI | InChI=1S/C17H21NO6S/c19-17-7-4-13-11-15(5-6-16(13)24-17)25(20,21)18-8-2-9-22-12-14-3-1-10-23-14/h4-7,11,14,18H,1-3,8-10,12H2/t14-/m1/s1 |
| InChIKey | OKUVOHHBVVYDJQ-CQSZACIVSA-N |
| XLogP | 1.66 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|