C17H25NO4S — CID 24511253
N-[3-(oxolan-2-ylmethoxy)propyl]-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 24511253) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)propyl]-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)propyl]-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 24511253 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)propyl]-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | O=S(=O)(NCCCOCC1CCCO1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H25NO4S/c19-23(20,17-8-7-14-4-1-5-15(14)12-17)18-9-3-10-21-13-16-6-2-11-22-16/h7-8,12,16,18H,1-6,9-11,13H2 |
| InChIKey | RPIFLIQNMVCZQB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|