C16H25NO3S — CID 32937376
N-(3-butoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 32937376) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(3-butoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 32937376 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-(3-butoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | CCCCOCCCNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H25NO3S/c1-2-3-11-20-12-5-10-17-21(18,19)16-9-8-14-6-4-7-15(14)13-16/h8-9,13,17H,2-7,10-12H2,1H3 |
| InChIKey | UNSLFUWBUMBCJZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|