C13H18N4O2S — CID 106386990
N-(4-azidobutyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 106386990) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-(4-azidobutyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(4-azidobutyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 106386990 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(4-azidobutyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | [N-]=[N+]=NCCCCNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H18N4O2S/c14-17-15-8-1-2-9-16-20(18,19)13-7-6-11-4-3-5-12(11)10-13/h6-7,10,16H,1-5,8-9H2 |
| InChIKey | ZASHJCXGRJUHCN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|