C11H15NO2S — CID 43212855
N-ethyl-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 43212855) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-ethyl-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-ethyl-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 43212855 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-ethyl-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H15NO2S/c1-2-12-15(13,14)11-7-6-9-4-3-5-10(9)8-11/h6-8,12H,2-5H2,1H3 |
| InChIKey | XCEYYXLAHBQHCC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |