C15H22BrNO2S — CID 107158218
N-(2-bromo-4-methylpentyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 107158218) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is N-(2-bromo-4-methylpentyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-bromo-4-methylpentyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 107158218 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(2-bromo-4-methylpentyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | CC(C)CC(Br)CNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H22BrNO2S/c1-11(2)8-14(16)10-17-20(18,19)15-7-6-12-4-3-5-13(12)9-15/h6-7,9,11,14,17H,3-5,8,10H2,1-2H3 |
| InChIKey | JAWYVFZQBNFLLO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|