C13H18ClNO3S — CID 65031254
N-(2-chloro-3-methoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide (PubChem CID 65031254) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide |
|---|---|
| PubChem CID | 65031254 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-2,3-dihydro-1H-indene-5-sulfonamide |
| SMILES | COCC(Cl)CNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H18ClNO3S/c1-18-9-12(14)8-15-19(16,17)13-6-5-10-3-2-4-11(10)7-13/h5-7,12,15H,2-4,8-9H2,1H3 |
| InChIKey | NRSPPMUJYOFFRM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|