C12H16N2O4S — CID 107258346
3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-2-hydroxypropanamide (PubChem CID 107258346) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-2-hydroxypropanamide.
| Compound Name | 3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107258346 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(2,3-dihydro-1H-inden-5-ylsulfonylamino)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H16N2O4S/c13-12(16)11(15)7-14-19(17,18)10-5-4-8-2-1-3-9(8)6-10/h4-6,11,14-15H,1-3,7H2,(H2,13,16) |
| InChIKey | ULEGTXINRTYWLA-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |