C10H12N2O7S — CID 106168283
5-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 106168283) has the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. Its IUPAC name is 5-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 106168283 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 5-[(3-amino-2-hydroxy-3-oxopropyl)sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H12N2O7S/c11-9(15)8(14)4-12-20(18,19)5-1-2-7(13)6(3-5)10(16)17/h1-3,8,12-14H,4H2,(H2,11,15)(H,16,17) |
| InChIKey | MZNNCPZOYJTODN-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |