C11H14N2O6S — CID 43214507
5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 43214507) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 43214507 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-[[2-(dimethylamino)-2-oxoethyl]sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O6S/c1-13(2)10(15)6-12-20(18,19)7-3-4-9(14)8(5-7)11(16)17/h3-5,12,14H,6H2,1-2H3,(H,16,17) |
| InChIKey | LLTYHVMFKOQSBN-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |