C12H13NO5S — CID 116642717
2-hydroxy-5-(pent-3-ynylsulfamoyl)benzoic acid (PubChem CID 116642717) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-hydroxy-5-(pent-3-ynylsulfamoyl)benzoic acid.
| Compound Name | 2-hydroxy-5-(pent-3-ynylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 116642717 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-hydroxy-5-(pent-3-ynylsulfamoyl)benzoic acid |
| SMILES | CC#CCCNS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H13NO5S/c1-2-3-4-7-13-19(17,18)9-5-6-11(14)10(8-9)12(15)16/h5-6,8,13-14H,4,7H2,1H3,(H,15,16) |
| InChIKey | GVNJOQIYAPEJFP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|