C11H15NO7S2 — CID 61019383
2-hydroxy-5-(3-methylsulfonylpropylsulfamoyl)benzoic acid (PubChem CID 61019383) has the molecular formula C11H15NO7S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-hydroxy-5-(3-methylsulfonylpropylsulfamoyl)benzoic acid.
| Compound Name | 2-hydroxy-5-(3-methylsulfonylpropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 61019383 |
| Molecular Formula | C11H15NO7S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-hydroxy-5-(3-methylsulfonylpropylsulfamoyl)benzoic acid |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H15NO7S2/c1-20(16,17)6-2-5-12-21(18,19)8-3-4-10(13)9(7-8)11(14)15/h3-4,7,12-13H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | YHCYPEBOHGQSGF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|