C9H12N2O5S — CID 61403327
5-(2-aminoethylsulfamoyl)-2-hydroxybenzoic acid (PubChem CID 61403327) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-(2-aminoethylsulfamoyl)-2-hydroxybenzoic acid.
| Compound Name | 5-(2-aminoethylsulfamoyl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61403327 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-(2-aminoethylsulfamoyl)-2-hydroxybenzoic acid |
| SMILES | NCCNS(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H12N2O5S/c10-3-4-11-17(15,16)6-1-2-8(12)7(5-6)9(13)14/h1-2,5,11-12H,3-4,10H2,(H,13,14) |
| InChIKey | IRQMAPAHRQZQHH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |