C13H18N2O6S — CID 8891748
2-hydroxy-5-(2-morpholin-4-ylethylsulfamoyl)benzoic acid (PubChem CID 8891748) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-hydroxy-5-(2-morpholin-4-ylethylsulfamoyl)benzoic acid.
| Compound Name | 2-hydroxy-5-(2-morpholin-4-ylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 8891748 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2-hydroxy-5-(2-morpholin-4-ylethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCN2CCOCC2)ccc1O |
| InChI | InChI=1S/C13H18N2O6S/c16-12-2-1-10(9-11(12)13(17)18)22(19,20)14-3-4-15-5-7-21-8-6-15/h1-2,9,14,16H,3-8H2,(H,17,18) |
| InChIKey | PNCUOPJHGHBDBV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |