C16H20ClN2O3S- — CID 45109707
N-(2-morpholin-4-ylethyl)naphthalene-2-sulfonamide chloride (PubChem CID 45109707) has the molecular formula C16H20ClN2O3S- and a molecular weight of 355.87 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)naphthalene-2-sulfonamide chloride.
| Compound Name | N-(2-morpholin-4-ylethyl)naphthalene-2-sulfonamide chloride |
|---|---|
| PubChem CID | 45109707 |
| Molecular Formula | C16H20ClN2O3S- |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)naphthalene-2-sulfonamide chloride |
| SMILES | O=S(=O)(NCCN1CCOCC1)c1ccc2ccccc2c1.[Cl-] |
| InChI | InChI=1S/C16H20N2O3S.ClH/c19-22(20,17-7-8-18-9-11-21-12-10-18)16-6-5-14-3-1-2-4-15(14)13-16;/h1-6,13,17H,7-12H2;1H/p-1 |
| InChIKey | CQKANUJCXRQUOP-UHFFFAOYSA-M |
| XLogP | -1.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |