C24H28N2O2S — CID 168832226
N-[3-(4-phenylpiperidin-1-yl)propyl]naphthalene-2-sulfonamide (PubChem CID 168832226) has the molecular formula C24H28N2O2S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[3-(4-phenylpiperidin-1-yl)propyl]naphthalene-2-sulfonamide.
| Compound Name | N-[3-(4-phenylpiperidin-1-yl)propyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 168832226 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[3-(4-phenylpiperidin-1-yl)propyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCC(c2ccccc2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H28N2O2S/c27-29(28,24-12-11-21-9-4-5-10-23(21)19-24)25-15-6-16-26-17-13-22(14-18-26)20-7-2-1-3-8-20/h1-5,7-12,19,22,25H,6,13-18H2 |
| InChIKey | HGLHFIUWUZONOW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|