C38H40N2O2S — CID 19045660
N-[2,2-diphenyl-5-(4-phenylpiperidin-1-yl)pentyl]naphthalene-2-sulfonamide (PubChem CID 19045660) has the molecular formula C38H40N2O2S and a molecular weight of 588.82 g/mol. Its IUPAC name is N-[2,2-diphenyl-5-(4-phenylpiperidin-1-yl)pentyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2,2-diphenyl-5-(4-phenylpiperidin-1-yl)pentyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 19045660 |
| Molecular Formula | C38H40N2O2S |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | N-[2,2-diphenyl-5-(4-phenylpiperidin-1-yl)pentyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(CCCN1CCC(c2ccccc2)CC1)(c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C38H40N2O2S/c41-43(42,37-22-21-32-15-10-11-16-34(32)29-37)39-30-38(35-17-6-2-7-18-35,36-19-8-3-9-20-36)25-12-26-40-27-23-33(24-28-40)31-13-4-1-5-14-31/h1-11,13-22,29,33,39H,12,23-28,30H2 |
| InChIKey | PQLGFEZCSAKDLY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |