C15H25NO7P2 — CID 11047477
[1-hydroxy-4-(4-phenylpiperidin-1-yl)-1-phosphonobutyl]phosphonic acid (PubChem CID 11047477) has the molecular formula C15H25NO7P2 and a molecular weight of 393.31 g/mol. Its IUPAC name is [1-hydroxy-4-(4-phenylpiperidin-1-yl)-1-phosphonobutyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-(4-phenylpiperidin-1-yl)-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 11047477 |
| Molecular Formula | C15H25NO7P2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [1-hydroxy-4-(4-phenylpiperidin-1-yl)-1-phosphonobutyl]phosphonic acid |
| SMILES | O=P(O)(O)C(O)(CCCN1CCC(c2ccccc2)CC1)P(=O)(O)O |
| InChI | InChI=1S/C15H25NO7P2/c17-15(24(18,19)20,25(21,22)23)9-4-10-16-11-7-14(8-12-16)13-5-2-1-3-6-13/h1-3,5-6,14,17H,4,7-12H2,(H2,18,19,20)(H2,21,22,23) |
| InChIKey | WPWJCHHUVZLWKL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|