C25H31NO4 — CID 11682970
(Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine (PubChem CID 11682970) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine.
| Compound Name | (Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine |
|---|---|
| PubChem CID | 11682970 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;4-phenyl-1-(4-phenylbutyl)piperidine |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc(CCCCN2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H27N.C4H4O4/c1-3-9-19(10-4-1)11-7-8-16-22-17-14-21(15-18-22)20-12-5-2-6-13-20;5-3(6)1-2-4(7)8/h1-6,9-10,12-13,21H,7-8,11,14-18H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OASPNIMFGJVLES-BTJKTKAUSA-N |
| XLogP | 4.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|