C16H23NO3 — CID 135107489
(3S,4R)-4-hydroxy-1-(4-phenylbutyl)piperidine-3-carboxylic acid (PubChem CID 135107489) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (3S,4R)-4-hydroxy-1-(4-phenylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3S,4R)-4-hydroxy-1-(4-phenylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135107489 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (3S,4R)-4-hydroxy-1-(4-phenylbutyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(CCCCc2ccccc2)CC[C@H]1O |
| InChI | InChI=1S/C16H23NO3/c18-15-9-11-17(12-14(15)16(19)20)10-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,14-15,18H,4-5,8-12H2,(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | UAGXOZFVPFNDMH-LSDHHAIUSA-N |
| XLogP | 1.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|