1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid

C15H19NO4 — CID 115918716

IUPAC1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CCN(CCc2ccccc2)CC1C(=O)O
InChIInChI=1S/C15H19NO4/c17-14(18)12-7-9-16(10-13(12)15(19)20)8-6-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18)(H,19,20)
InChIKeyCBFSWFZGBXKMGH-UHFFFAOYSA-N
MW277.32 g/mol
LogP1.34
Rot. Bonds5

About 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid

1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918716) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid.

Molecular Properties

Compound Name1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid
PubChem CID115918716
Molecular FormulaC15H19NO4
Molecular Weight277.32 g/mol
Exact Mass277.13
IUPAC Name1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CCN(CCc2ccccc2)CC1C(=O)O
InChIInChI=1S/C15H19NO4/c17-14(18)12-7-9-16(10-13(12)15(19)20)8-6-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18)(H,19,20)
InChIKeyCBFSWFZGBXKMGH-UHFFFAOYSA-N
XLogP1.34
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.32
LogP ≤ 51.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid?
The IUPAC name of 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid (CID 115918716) is 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid.
What is the SMILES notation for 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid?
The canonical SMILES for 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid is O=C(O)C1CCN(CCc2ccccc2)CC1C(=O)O.
What is the InChIKey of 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid?
The InChIKey is CBFSWFZGBXKMGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c17-14(18)12-7-9-16(10-13(12)15(19)20)8-6-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,17,18)(H,19,20).
What are the key properties of 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid?
1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid has a molecular weight of 277.32 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenylethyl)piperidine-3,4-dicarboxylic acid is sourced from PubChem (CID 115918716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).