C13H19N3O4 — CID 103004943
1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine-3,4-dicarboxylic acid (PubChem CID 103004943) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 103004943 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-[2-(1-methylpyrazol-4-yl)ethyl]piperidine-3,4-dicarboxylic acid |
| SMILES | Cn1cc(CCN2CCC(C(=O)O)C(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C13H19N3O4/c1-15-7-9(6-14-15)2-4-16-5-3-10(12(17)18)11(8-16)13(19)20/h6-7,10-11H,2-5,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | ODMAIPTYPOVAFV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |