C22H32N4 — CID 45205063
1-[(1-methylpyrazol-4-yl)methyl]-4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidine (PubChem CID 45205063) has the molecular formula C22H32N4 and a molecular weight of 352.53 g/mol. Its IUPAC name is 1-[(1-methylpyrazol-4-yl)methyl]-4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidine.
| Compound Name | 1-[(1-methylpyrazol-4-yl)methyl]-4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidine |
|---|---|
| PubChem CID | 45205063 |
| Molecular Formula | C22H32N4 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 1-[(1-methylpyrazol-4-yl)methyl]-4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidine |
| SMILES | Cn1cc(CN2CCC(C3CCN(CCc4ccccc4)C3)CC2)cn1 |
| InChI | InChI=1S/C22H32N4/c1-24-16-20(15-23-24)17-25-12-8-21(9-13-25)22-10-14-26(18-22)11-7-19-5-3-2-4-6-19/h2-6,15-16,21-22H,7-14,17-18H2,1H3 |
| InChIKey | YTXVNYDEMFNGEB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |