C22H29N3O2S — CID 45226112
3-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]sulfonylpyridine (PubChem CID 45226112) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]sulfonylpyridine.
| Compound Name | 3-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 45226112 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 3-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]sulfonylpyridine |
| SMILES | O=S(=O)(c1cccnc1)N1CCC(C2CCN(CCc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C22H29N3O2S/c26-28(27,22-7-4-12-23-17-22)25-15-10-20(11-16-25)21-9-14-24(18-21)13-8-19-5-2-1-3-6-19/h1-7,12,17,20-21H,8-11,13-16,18H2 |
| InChIKey | JVWDTUQPQINZGX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |