C26H29N3O3S — CID 30892157
N-(3,3-diphenylpropyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 30892157) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(3,3-diphenylpropyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 30892157 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-(3,3-diphenylpropyl)-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C26H29N3O3S/c30-26(23-14-18-29(19-15-23)33(31,32)24-12-7-16-27-20-24)28-17-13-25(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-12,16,20,23,25H,13-15,17-19H2,(H,28,30) |
| InChIKey | XWBFWBMTZVVIIP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |